C12H19NO4 — CID 139617233
prop-2-enyl (2S,4R)-4-hydroxy-2-[(E)-3-methoxyprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 139617233) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-hydroxy-2-[(E)-3-methoxyprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-hydroxy-2-[(E)-3-methoxyprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139617233 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-hydroxy-2-[(E)-3-methoxyprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O)C[C@H]1/C=C/COC |
| InChI | InChI=1S/C12H19NO4/c1-3-6-17-12(15)13-9-11(14)8-10(13)5-4-7-16-2/h3-5,10-11,14H,1,6-9H2,2H3/b5-4+/t10-,11-/m1/s1 |
| InChIKey | WXHNXEGWOYFRQK-XKFHPXPTSA-N |
| XLogP | 0.95 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|