C21H19NO5 — CID 139617435
methyl 1-(3-methoxy-2,4-dimethyl-6-nitrophenyl)naphthalene-2-carboxylate (PubChem CID 139617435) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 1-(3-methoxy-2,4-dimethyl-6-nitrophenyl)naphthalene-2-carboxylate.
| Compound Name | methyl 1-(3-methoxy-2,4-dimethyl-6-nitrophenyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139617435 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 1-(3-methoxy-2,4-dimethyl-6-nitrophenyl)naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2ccccc2c1-c1c([N+](=O)[O-])cc(C)c(OC)c1C |
| InChI | InChI=1S/C21H19NO5/c1-12-11-17(22(24)25)18(13(2)20(12)26-3)19-15-8-6-5-7-14(15)9-10-16(19)21(23)27-4/h5-11H,1-4H3 |
| InChIKey | CRHXLMVICISWBP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|