About 2H-benzo[g][3,1]benzoxazine
2H-benzo[g][3,1]benzoxazine (PubChem CID 139617827) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2H-benzo[g][3,1]benzoxazine.
Molecular Properties
| Compound Name | 2H-benzo[g][3,1]benzoxazine |
| PubChem CID | 139617827 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2H-benzo[g][3,1]benzoxazine |
| SMILES | C1=c2cc3ccccc3cc2=NCO1 |
| InChI | InChI=1S/C12H9NO/c1-2-4-10-6-12-11(5-9(10)3-1)7-14-8-13-12/h1-7H,8H2 |
| InChIKey | RJOAINOTWUPARS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-benzo[g][3,1]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzo[g][3,1]benzoxazine?
The IUPAC name of 2H-benzo[g][3,1]benzoxazine (CID 139617827) is 2H-benzo[g][3,1]benzoxazine.
What is the SMILES notation for 2H-benzo[g][3,1]benzoxazine?
The canonical SMILES for 2H-benzo[g][3,1]benzoxazine is C1=c2cc3ccccc3cc2=NCO1.
What is the InChIKey of 2H-benzo[g][3,1]benzoxazine?
The InChIKey is RJOAINOTWUPARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-2-4-10-6-12-11(5-9(10)3-1)7-14-8-13-12/h1-7H,8H2.
What are the key properties of 2H-benzo[g][3,1]benzoxazine?
2H-benzo[g][3,1]benzoxazine has a molecular weight of 183.21 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzo[g][3,1]benzoxazine is sourced from PubChem (CID 139617827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).