C23H23NO6S — CID 139619035
2-[4-(4-hydroxy-1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenoxy]acetic acid (PubChem CID 139619035) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(4-hydroxy-1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 139619035 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2-[4-(4-hydroxy-1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C2(O)CCN(S(=O)(=O)c3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H23NO6S/c25-22(26)16-30-19-10-8-18(9-11-19)23(27)12-14-24(15-13-23)31(28,29)21-7-3-5-17-4-1-2-6-20(17)21/h1-11,27H,12-16H2,(H,25,26) |
| InChIKey | FOPGAFDIIMOSOS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |