C20H30O4 — CID 139619829
(5Z)-15-hydroxy-14-oxoicosa-5,8,11,17-tetraenoic acid (PubChem CID 139619829) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (5Z)-15-hydroxy-14-oxoicosa-5,8,11,17-tetraenoic acid.
| Compound Name | (5Z)-15-hydroxy-14-oxoicosa-5,8,11,17-tetraenoic acid |
|---|---|
| PubChem CID | 139619829 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (5Z)-15-hydroxy-14-oxoicosa-5,8,11,17-tetraenoic acid |
| SMILES | CCC=CCC(O)C(=O)CC=CCC=CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-12-15-18(21)19(22)16-13-10-8-6-4-5-7-9-11-14-17-20(23)24/h3-4,6-7,9-10,12-13,18,21H,2,5,8,11,14-17H2,1H3,(H,23,24)/b6-4?,9-7-,12-3?,13-10? |
| InChIKey | SRTZIKLTFOLNLO-QSVQDVTFSA-N |
| XLogP | 4.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|