C18H22N2O4 — CID 139622100
butan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 139622100) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is butan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | butan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 139622100 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | butan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCC(C)OC(=O)C1=C(C)NC(C)=CC1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N2O4/c1-5-12(3)24-18(21)17-13(4)19-11(2)9-16(17)14-7-6-8-15(10-14)20(22)23/h6-10,12,16,19H,5H2,1-4H3 |
| InChIKey | LBXYIAXMYVTJEN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|