C24H28O6 — CID 139626226
(E)-3-(2,3-dimethoxyphenyl)-2-hydroxy-1-[2-(1-hydroxycyclohexyl)phenyl]-3-methoxyprop-2-en-1-one (PubChem CID 139626226) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-2-hydroxy-1-[2-(1-hydroxycyclohexyl)phenyl]-3-methoxyprop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-2-hydroxy-1-[2-(1-hydroxycyclohexyl)phenyl]-3-methoxyprop-2-en-1-one |
|---|---|
| PubChem CID | 139626226 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-2-hydroxy-1-[2-(1-hydroxycyclohexyl)phenyl]-3-methoxyprop-2-en-1-one |
| SMILES | CO/C(=C(/O)C(=O)c1ccccc1C1(O)CCCCC1)c1cccc(OC)c1OC |
| InChI | InChI=1S/C24H28O6/c1-28-19-13-9-11-17(22(19)29-2)23(30-3)21(26)20(25)16-10-5-6-12-18(16)24(27)14-7-4-8-15-24/h5-6,9-13,26-27H,4,7-8,14-15H2,1-3H3/b23-21+ |
| InChIKey | WOFMVLRDKIXWMH-XTQSDGFTSA-N |
| XLogP | 4.61 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|