C14H19NO6 — CID 139626521
(3R,4S,5R)-3,4,5,6-tetrahydroxy-N-[(4-methoxyphenyl)methylidene]hexanamide (PubChem CID 139626521) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-[(4-methoxyphenyl)methylidene]hexanamide.
| Compound Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-[(4-methoxyphenyl)methylidene]hexanamide |
|---|---|
| PubChem CID | 139626521 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-[(4-methoxyphenyl)methylidene]hexanamide |
| SMILES | COc1ccc(/C=N/C(=O)C[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C14H19NO6/c1-21-10-4-2-9(3-5-10)7-15-13(19)6-11(17)14(20)12(18)8-16/h2-5,7,11-12,14,16-18,20H,6,8H2,1H3/b15-7+/t11-,12-,14+/m1/s1 |
| InChIKey | KRCQTEGCCLEKDV-MPDVIWQQSA-N |
| XLogP | -0.89 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|