C14H19NO6 — CID 19817378
3,4,5,6-tetrahydroxy-2-[(4-methoxyphenyl)methylideneamino]hexanal (PubChem CID 19817378) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-2-[(4-methoxyphenyl)methylideneamino]hexanal.
| Compound Name | 3,4,5,6-tetrahydroxy-2-[(4-methoxyphenyl)methylideneamino]hexanal |
|---|---|
| PubChem CID | 19817378 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-2-[(4-methoxyphenyl)methylideneamino]hexanal |
| SMILES | COc1ccc(/C=N/C(C=O)C(O)C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C14H19NO6/c1-21-10-4-2-9(3-5-10)6-15-11(7-16)13(19)14(20)12(18)8-17/h2-7,11-14,17-20H,8H2,1H3/b15-6+ |
| InChIKey | LGBIIFHETPIPEX-GIDUJCDVSA-N |
| XLogP | -1.24 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|