C12H18N2O6 — CID 121010077
(2S,3R,4R)-2,3,4,5-tetrahydroxy-N-(4-methoxyphenyl)pentanehydrazide (PubChem CID 121010077) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4,5-tetrahydroxy-N-(4-methoxyphenyl)pentanehydrazide.
| Compound Name | (2S,3R,4R)-2,3,4,5-tetrahydroxy-N-(4-methoxyphenyl)pentanehydrazide |
|---|---|
| PubChem CID | 121010077 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2S,3R,4R)-2,3,4,5-tetrahydroxy-N-(4-methoxyphenyl)pentanehydrazide |
| SMILES | COc1ccc(N(N)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C12H18N2O6/c1-20-8-4-2-7(3-5-8)14(13)12(19)11(18)10(17)9(16)6-15/h2-5,9-11,15-18H,6,13H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | VDPKJJNSWZFOJL-MXWKQRLJSA-N |
| XLogP | -2.02 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|