C22H37NO4 — CID 139627495
2-nitro-1,4-bis(2,4,4-trimethylpentan-2-yloxy)benzene (PubChem CID 139627495) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-nitro-1,4-bis(2,4,4-trimethylpentan-2-yloxy)benzene.
| Compound Name | 2-nitro-1,4-bis(2,4,4-trimethylpentan-2-yloxy)benzene |
|---|---|
| PubChem CID | 139627495 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-nitro-1,4-bis(2,4,4-trimethylpentan-2-yloxy)benzene |
| SMILES | CC(C)(C)CC(C)(C)Oc1ccc(OC(C)(C)CC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H37NO4/c1-19(2,3)14-21(7,8)26-16-11-12-18(17(13-16)23(24)25)27-22(9,10)15-20(4,5)6/h11-13H,14-15H2,1-10H3 |
| InChIKey | NDNXLLHPZSZLHQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|