C16H19NO — CID 139632389
1-(methylamino)-1,1-diphenylpropan-2-ol (PubChem CID 139632389) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-(methylamino)-1,1-diphenylpropan-2-ol.
| Compound Name | 1-(methylamino)-1,1-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 139632389 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-(methylamino)-1,1-diphenylpropan-2-ol |
| SMILES | CNC(c1ccccc1)(c1ccccc1)C(C)O |
| InChI | InChI=1S/C16H19NO/c1-13(18)16(17-2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,17-18H,1-2H3 |
| InChIKey | GIAGXYLVNWMHLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |