C21H23NSi — CID 173425344
1,1,2-triphenyl-N-silylpropan-1-amine (PubChem CID 173425344) has the molecular formula C21H23NSi and a molecular weight of 317.51 g/mol. Its IUPAC name is 1,1,2-triphenyl-N-silylpropan-1-amine.
| Compound Name | 1,1,2-triphenyl-N-silylpropan-1-amine |
|---|---|
| PubChem CID | 173425344 |
| Molecular Formula | C21H23NSi |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1,1,2-triphenyl-N-silylpropan-1-amine |
| SMILES | CC(c1ccccc1)C(N[SiH3])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NSi/c1-17(18-11-5-2-6-12-18)21(22-23,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,22H,1,23H3 |
| InChIKey | MSQSBAOIJYAEAJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|