C17H21N3O5 — CID 139632517
ethyl 3,5-dimethyl-2-(3-nitro-4-propan-2-yloxyphenyl)imidazole-4-carboxylate (PubChem CID 139632517) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-2-(3-nitro-4-propan-2-yloxyphenyl)imidazole-4-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-2-(3-nitro-4-propan-2-yloxyphenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 139632517 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl 3,5-dimethyl-2-(3-nitro-4-propan-2-yloxyphenyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2ccc(OC(C)C)c([N+](=O)[O-])c2)n1C |
| InChI | InChI=1S/C17H21N3O5/c1-6-24-17(21)15-11(4)18-16(19(15)5)12-7-8-14(25-10(2)3)13(9-12)20(22)23/h7-10H,6H2,1-5H3 |
| InChIKey | NPMHECHSXWWDKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|