C18H11ClF3NO3 — CID 139632570
[3-(trifluoromethyl)phenyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 139632570) has the molecular formula C18H11ClF3NO3 and a molecular weight of 381.74 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 139632570 |
| Molecular Formula | C18H11ClF3NO3 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11ClF3NO3/c1-10-15(16(23-26-10)13-7-2-3-8-14(13)19)17(24)25-12-6-4-5-11(9-12)18(20,21)22/h2-9H,1H3 |
| InChIKey | NPUUJKUVZTZILX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|