C20H24N4O7S — CID 139635856
N'-[5-(methanesulfonamido)-2-nitro-4-phenoxyphenyl]-N-pentyloxamide (PubChem CID 139635856) has the molecular formula C20H24N4O7S and a molecular weight of 464.50 g/mol. Its IUPAC name is N'-[5-(methanesulfonamido)-2-nitro-4-phenoxyphenyl]-N-pentyloxamide.
| Compound Name | N'-[5-(methanesulfonamido)-2-nitro-4-phenoxyphenyl]-N-pentyloxamide |
|---|---|
| PubChem CID | 139635856 |
| Molecular Formula | C20H24N4O7S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N'-[5-(methanesulfonamido)-2-nitro-4-phenoxyphenyl]-N-pentyloxamide |
| SMILES | CCCCCNC(=O)C(=O)Nc1cc(NS(C)(=O)=O)c(Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N4O7S/c1-3-4-8-11-21-19(25)20(26)22-15-12-16(23-32(2,29)30)18(13-17(15)24(27)28)31-14-9-6-5-7-10-14/h5-7,9-10,12-13,23H,3-4,8,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | LKKSJIZIAYMPSO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|