C20H23N3O8S — CID 139618763
methyl 6-[5-(methanesulfonamido)-2-nitro-4-phenoxyanilino]-6-oxohexanoate (PubChem CID 139618763) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is methyl 6-[5-(methanesulfonamido)-2-nitro-4-phenoxyanilino]-6-oxohexanoate.
| Compound Name | methyl 6-[5-(methanesulfonamido)-2-nitro-4-phenoxyanilino]-6-oxohexanoate |
|---|---|
| PubChem CID | 139618763 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | methyl 6-[5-(methanesulfonamido)-2-nitro-4-phenoxyanilino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)Nc1cc(NS(C)(=O)=O)c(Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N3O8S/c1-30-20(25)11-7-6-10-19(24)21-15-12-16(22-32(2,28)29)18(13-17(15)23(26)27)31-14-8-4-3-5-9-14/h3-5,8-9,12-13,22H,6-7,10-11H2,1-2H3,(H,21,24) |
| InChIKey | CINOAARMKZAWIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|