C20H25N3O3S — CID 139635978
2-[4-[2-(1-oxo-1,3-benzothiazol-7-yl)ethylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 139635978) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[4-[2-(1-oxo-1,3-benzothiazol-7-yl)ethylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-[4-[2-(1-oxo-1,3-benzothiazol-7-yl)ethylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 139635978 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[4-[2-(1-oxo-1,3-benzothiazol-7-yl)ethylamino]butyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | O=C1C2CCCC2C(=O)N1CCCCNCCc1cccc2c1S(=O)C=N2 |
| InChI | InChI=1S/C20H25N3O3S/c24-19-15-6-4-7-16(15)20(25)23(19)12-2-1-10-21-11-9-14-5-3-8-17-18(14)27(26)13-22-17/h3,5,8,13,15-16,21H,1-2,4,6-7,9-12H2 |
| InChIKey | WXBNXGOBFIWIGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|