C29H37BrO5 — CID 139636739
2-(5-bromopentoxy)-3-[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]propan-1-ol (PubChem CID 139636739) has the molecular formula C29H37BrO5 and a molecular weight of 545.51 g/mol. Its IUPAC name is 2-(5-bromopentoxy)-3-[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]propan-1-ol.
| Compound Name | 2-(5-bromopentoxy)-3-[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]propan-1-ol |
|---|---|
| PubChem CID | 139636739 |
| Molecular Formula | C29H37BrO5 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-(5-bromopentoxy)-3-[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]propan-1-ol |
| SMILES | COC1(OC)C=CC(C(OCC(CO)OCCCCCBr)(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C29H37BrO5/c1-32-28(33-2)18-16-26(17-19-28)29(24-12-6-3-7-13-24,25-14-8-4-9-15-25)35-23-27(22-31)34-21-11-5-10-20-30/h3-4,6-9,12-18,27,31H,5,10-11,19-23H2,1-2H3 |
| InChIKey | YIBOFBRYSIUJKA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|