C8H11NO — CID 139637655
N-[(1E,3E)-hexa-1,3,5-trienyl]acetamide (PubChem CID 139637655) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is N-[(1E,3E)-hexa-1,3,5-trienyl]acetamide.
| Compound Name | N-[(1E,3E)-hexa-1,3,5-trienyl]acetamide |
|---|---|
| PubChem CID | 139637655 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | N-[(1E,3E)-hexa-1,3,5-trienyl]acetamide |
| SMILES | C=C/C=C/C=C/NC(C)=O |
| InChI | InChI=1S/C8H11NO/c1-3-4-5-6-7-9-8(2)10/h3-7H,1H2,2H3,(H,9,10)/b5-4+,7-6+ |
| InChIKey | ZOFLTAHVCQMPKC-YTXTXJHMSA-N |
| XLogP | 1.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|