C8H10FNO — CID 167498199
N-[(1E,3E)-5-fluorohexa-1,3,5-trienyl]acetamide (PubChem CID 167498199) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is N-[(1E,3E)-5-fluorohexa-1,3,5-trienyl]acetamide.
| Compound Name | N-[(1E,3E)-5-fluorohexa-1,3,5-trienyl]acetamide |
|---|---|
| PubChem CID | 167498199 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-[(1E,3E)-5-fluorohexa-1,3,5-trienyl]acetamide |
| SMILES | C=C(F)/C=C/C=C/NC(C)=O |
| InChI | InChI=1S/C8H10FNO/c1-7(9)5-3-4-6-10-8(2)11/h3-6H,1H2,2H3,(H,10,11)/b5-3+,6-4+ |
| InChIKey | YIIMSSGGUFUNML-GGWOSOGESA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|