C14H11Cl3N2O6S — CID 139638251
4-(2-hydroxyethoxy)-3-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide (PubChem CID 139638251) has the molecular formula C14H11Cl3N2O6S and a molecular weight of 441.68 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-3-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide.
| Compound Name | 4-(2-hydroxyethoxy)-3-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 139638251 |
| Molecular Formula | C14H11Cl3N2O6S |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | 4-(2-hydroxyethoxy)-3-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)ccc1OCCO |
| InChI | InChI=1S/C14H11Cl3N2O6S/c15-9-6-11(17)12(7-10(9)16)18-26(23,24)8-1-2-14(25-4-3-20)13(5-8)19(21)22/h1-2,5-7,18,20H,3-4H2 |
| InChIKey | IMOQIFMYCOLKQE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|