C10H20N2O2 — CID 139640627
(2,2,3,3-tetramethylpiperidin-1-yl) carbamate (PubChem CID 139640627) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2,2,3,3-tetramethylpiperidin-1-yl) carbamate.
| Compound Name | (2,2,3,3-tetramethylpiperidin-1-yl) carbamate |
|---|---|
| PubChem CID | 139640627 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (2,2,3,3-tetramethylpiperidin-1-yl) carbamate |
| SMILES | CC1(C)CCCN(OC(N)=O)C1(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2)6-5-7-12(10(9,3)4)14-8(11)13/h5-7H2,1-4H3,(H2,11,13) |
| InChIKey | JAURWOLMWMCBDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |