About 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide
3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide (PubChem CID 166144717) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide.
Molecular Properties
| Compound Name | 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide |
| PubChem CID | 166144717 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide |
| SMILES | CN1CCCC1(C)C#CC(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-9(6-4-8(10)12)5-3-7-11(9)2/h3,5,7H2,1-2H3,(H2,10,12) |
| InChIKey | LMBKNNGEXTYTHF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide?
The IUPAC name of 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide (CID 166144717) is 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide.
What is the SMILES notation for 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide?
The canonical SMILES for 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide is CN1CCCC1(C)C#CC(N)=O.
What is the InChIKey of 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide?
The InChIKey is LMBKNNGEXTYTHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-9(6-4-8(10)12)5-3-7-11(9)2/h3,5,7H2,1-2H3,(H2,10,12).
What are the key properties of 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide?
3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide has a molecular weight of 166.22 g/mol, XLogP of -0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dimethylpyrrolidin-2-yl)prop-2-ynamide is sourced from PubChem (CID 166144717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).