C11H5N3O — CID 139640777
8-hydroxyquinoline-3,6-dicarbonitrile (PubChem CID 139640777) has the molecular formula C11H5N3O and a molecular weight of 195.18 g/mol. Its IUPAC name is 8-hydroxyquinoline-3,6-dicarbonitrile.
| Compound Name | 8-hydroxyquinoline-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 139640777 |
| Molecular Formula | C11H5N3O |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 8-hydroxyquinoline-3,6-dicarbonitrile |
| SMILES | N#Cc1cnc2c(O)cc(C#N)cc2c1 |
| InChI | InChI=1S/C11H5N3O/c12-4-7-1-9-2-8(5-13)6-14-11(9)10(15)3-7/h1-3,6,15H |
| InChIKey | IOHLCIQNRPDJBY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |