C33H36O4 — CID 139641149
3-[4-[[4-(3-hydroxypropoxy)-3-methylphenyl]-diphenylmethyl]-2-methylphenoxy]propan-1-ol (PubChem CID 139641149) has the molecular formula C33H36O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-[4-[[4-(3-hydroxypropoxy)-3-methylphenyl]-diphenylmethyl]-2-methylphenoxy]propan-1-ol.
| Compound Name | 3-[4-[[4-(3-hydroxypropoxy)-3-methylphenyl]-diphenylmethyl]-2-methylphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 139641149 |
| Molecular Formula | C33H36O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-[4-[[4-(3-hydroxypropoxy)-3-methylphenyl]-diphenylmethyl]-2-methylphenoxy]propan-1-ol |
| SMILES | Cc1cc(C(c2ccccc2)(c2ccccc2)c2ccc(OCCCO)c(C)c2)ccc1OCCCO |
| InChI | InChI=1S/C33H36O4/c1-25-23-29(15-17-31(25)36-21-9-19-34)33(27-11-5-3-6-12-27,28-13-7-4-8-14-28)30-16-18-32(26(2)24-30)37-22-10-20-35/h3-8,11-18,23-24,34-35H,9-10,19-22H2,1-2H3 |
| InChIKey | XJOBQNMQRMBBRY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|