C28H33NO2 — CID 54294162
3-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-1,3-diphenylbutan-1-one (PubChem CID 54294162) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-1,3-diphenylbutan-1-one.
| Compound Name | 3-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 54294162 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 3-[4-[3-(dimethylamino)propoxy]-3-methylphenyl]-1,3-diphenylbutan-1-one |
| SMILES | Cc1cc(C(C)(CC(=O)c2ccccc2)c2ccccc2)ccc1OCCCN(C)C |
| InChI | InChI=1S/C28H33NO2/c1-22-20-25(16-17-27(22)31-19-11-18-29(3)4)28(2,24-14-9-6-10-15-24)21-26(30)23-12-7-5-8-13-23/h5-10,12-17,20H,11,18-19,21H2,1-4H3 |
| InChIKey | RZPNNPOSIBKLFK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|