C17H14FNOS — CID 139641696
5-[2-(5-fluoro-1,3-benzothiazol-2-yl)cyclopropyl]-2-methylphenol (PubChem CID 139641696) has the molecular formula C17H14FNOS and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-[2-(5-fluoro-1,3-benzothiazol-2-yl)cyclopropyl]-2-methylphenol.
| Compound Name | 5-[2-(5-fluoro-1,3-benzothiazol-2-yl)cyclopropyl]-2-methylphenol |
|---|---|
| PubChem CID | 139641696 |
| Molecular Formula | C17H14FNOS |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5-[2-(5-fluoro-1,3-benzothiazol-2-yl)cyclopropyl]-2-methylphenol |
| SMILES | Cc1ccc(C2CC2c2nc3cc(F)ccc3s2)cc1O |
| InChI | InChI=1S/C17H14FNOS/c1-9-2-3-10(6-15(9)20)12-8-13(12)17-19-14-7-11(18)4-5-16(14)21-17/h2-7,12-13,20H,8H2,1H3 |
| InChIKey | XPJYTBFWLNFRRS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |