About 5-fluoro-2-methylphenol;oxolan-3-ol
5-fluoro-2-methylphenol;oxolan-3-ol (PubChem CID 144854815) has the molecular formula C11H15FO3
and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-fluoro-2-methylphenol;oxolan-3-ol.
Molecular Properties
| Compound Name | 5-fluoro-2-methylphenol;oxolan-3-ol |
| PubChem CID | 144854815 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-fluoro-2-methylphenol;oxolan-3-ol |
| SMILES | Cc1ccc(F)cc1O.OC1CCOC1 |
| InChI | InChI=1S/C7H7FO.C4H8O2/c1-5-2-3-6(8)4-7(5)9;5-4-1-2-6-3-4/h2-4,9H,1H3;4-5H,1-3H2 |
| InChIKey | QCRBFIZYPCMDTE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-2-methylphenol;oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylphenol;oxolan-3-ol?
The IUPAC name of 5-fluoro-2-methylphenol;oxolan-3-ol (CID 144854815) is 5-fluoro-2-methylphenol;oxolan-3-ol.
What is the SMILES notation for 5-fluoro-2-methylphenol;oxolan-3-ol?
The canonical SMILES for 5-fluoro-2-methylphenol;oxolan-3-ol is Cc1ccc(F)cc1O.OC1CCOC1.
What is the InChIKey of 5-fluoro-2-methylphenol;oxolan-3-ol?
The InChIKey is QCRBFIZYPCMDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.C4H8O2/c1-5-2-3-6(8)4-7(5)9;5-4-1-2-6-3-4/h2-4,9H,1H3;4-5H,1-3H2.
What are the key properties of 5-fluoro-2-methylphenol;oxolan-3-ol?
5-fluoro-2-methylphenol;oxolan-3-ol has a molecular weight of 214.24 g/mol, XLogP of 1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylphenol;oxolan-3-ol is sourced from PubChem (CID 144854815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).