About 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid
5-fluoro-2-methylphenol;2-methylprop-2-enoic acid (PubChem CID 175752999) has the molecular formula C11H13FO3
and a molecular weight of 212.22 g/mol. Its IUPAC name is 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid |
| PubChem CID | 175752999 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.Cc1ccc(F)cc1O |
| InChI | InChI=1S/C7H7FO.C4H6O2/c1-5-2-3-6(8)4-7(5)9;1-3(2)4(5)6/h2-4,9H,1H3;1H2,2H3,(H,5,6) |
| InChIKey | DUBOKMFQYHSEDW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid?
The IUPAC name of 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid (CID 175752999) is 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid.
What is the SMILES notation for 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid?
The canonical SMILES for 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid is C=C(C)C(=O)O.Cc1ccc(F)cc1O.
What is the InChIKey of 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid?
The InChIKey is DUBOKMFQYHSEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.C4H6O2/c1-5-2-3-6(8)4-7(5)9;1-3(2)4(5)6/h2-4,9H,1H3;1H2,2H3,(H,5,6).
What are the key properties of 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid?
5-fluoro-2-methylphenol;2-methylprop-2-enoic acid has a molecular weight of 212.22 g/mol, XLogP of 2.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylphenol;2-methylprop-2-enoic acid is sourced from PubChem (CID 175752999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).