C38H42N2O6 — CID 139641828
2-methyl-4-[1-methyl-4-[2-[3-methyl-4-(3-methyl-4-nitrophenoxy)phenyl]propan-2-yl]cyclohexyl]-1-(3-methyl-4-nitrophenoxy)benzene (PubChem CID 139641828) has the molecular formula C38H42N2O6 and a molecular weight of 622.76 g/mol. Its IUPAC name is 2-methyl-4-[1-methyl-4-[2-[3-methyl-4-(3-methyl-4-nitrophenoxy)phenyl]propan-2-yl]cyclohexyl]-1-(3-methyl-4-nitrophenoxy)benzene.
| Compound Name | 2-methyl-4-[1-methyl-4-[2-[3-methyl-4-(3-methyl-4-nitrophenoxy)phenyl]propan-2-yl]cyclohexyl]-1-(3-methyl-4-nitrophenoxy)benzene |
|---|---|
| PubChem CID | 139641828 |
| Molecular Formula | C38H42N2O6 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 2-methyl-4-[1-methyl-4-[2-[3-methyl-4-(3-methyl-4-nitrophenoxy)phenyl]propan-2-yl]cyclohexyl]-1-(3-methyl-4-nitrophenoxy)benzene |
| SMILES | Cc1cc(C2(C)CCC(C(C)(C)c3ccc(Oc4ccc([N+](=O)[O-])c(C)c4)c(C)c3)CC2)ccc1Oc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C38H42N2O6/c1-24-22-31(10-12-33(24)39(41)42)45-35-14-8-29(20-26(35)3)37(5,6)28-16-18-38(7,19-17-28)30-9-15-36(27(4)21-30)46-32-11-13-34(40(43)44)25(2)23-32/h8-15,20-23,28H,16-19H2,1-7H3 |
| InChIKey | QPALBICLNHIURU-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|