C27H33BCl2S — CID 139642206
3,3-bis(4-chlorophenyl)prop-2-enylsulfanium;triethyl(phenyl)boranuide (PubChem CID 139642206) has the molecular formula C27H33BCl2S and a molecular weight of 471.35 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)prop-2-enylsulfanium;triethyl(phenyl)boranuide.
| Compound Name | 3,3-bis(4-chlorophenyl)prop-2-enylsulfanium;triethyl(phenyl)boranuide |
|---|---|
| PubChem CID | 139642206 |
| Molecular Formula | C27H33BCl2S |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)prop-2-enylsulfanium;triethyl(phenyl)boranuide |
| SMILES | CC[B-](CC)(CC)c1ccccc1.[SH2+]CC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2S.C12H20B/c16-13-5-1-11(2-6-13)15(9-10-18)12-3-7-14(17)8-4-12;1-4-13(5-2,6-3)12-10-8-7-9-11-12/h1-9,18H,10H2;7-11H,4-6H2,1-3H3/q;-1/p+1 |
| InChIKey | XIPOSJVHINRUNP-UHFFFAOYSA-O |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|