C23H22Cl2O4S — CID 71419576
4,4-bis(4-chlorophenyl)but-3-en-1-ol;4-methylbenzenesulfonic acid (PubChem CID 71419576) has the molecular formula C23H22Cl2O4S and a molecular weight of 465.40 g/mol. Its IUPAC name is 4,4-bis(4-chlorophenyl)but-3-en-1-ol;4-methylbenzenesulfonic acid.
| Compound Name | 4,4-bis(4-chlorophenyl)but-3-en-1-ol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 71419576 |
| Molecular Formula | C23H22Cl2O4S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4,4-bis(4-chlorophenyl)but-3-en-1-ol;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCCC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2O.C7H8O3S/c17-14-7-3-12(4-8-14)16(2-1-11-19)13-5-9-15(18)10-6-13;1-6-2-4-7(5-3-6)11(8,9)10/h2-10,19H,1,11H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | DMUCQEBSLPAPFD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|