C17H19ClN2O3S — CID 134109979
4-chloro-N'-prop-2-enylbenzenecarboximidamide;4-methylbenzenesulfonic acid (PubChem CID 134109979) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 4-chloro-N'-prop-2-enylbenzenecarboximidamide;4-methylbenzenesulfonic acid.
| Compound Name | 4-chloro-N'-prop-2-enylbenzenecarboximidamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 134109979 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 4-chloro-N'-prop-2-enylbenzenecarboximidamide;4-methylbenzenesulfonic acid |
| SMILES | C=CC/N=C(\N)c1ccc(Cl)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H11ClN2.C7H8O3S/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-6-2-4-7(5-3-6)11(8,9)10/h2-6H,1,7H2,(H2,12,13);2-5H,1H3,(H,8,9,10) |
| InChIKey | JRHSBQZHQDEJET-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|