C20H17ClN2O3S — CID 134117835
4-[[4-[[amino-(4-chlorophenyl)methylidene]amino]phenyl]methyl]benzenesulfonic acid (PubChem CID 134117835) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is 4-[[4-[[amino-(4-chlorophenyl)methylidene]amino]phenyl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[amino-(4-chlorophenyl)methylidene]amino]phenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 134117835 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-[[4-[[amino-(4-chlorophenyl)methylidene]amino]phenyl]methyl]benzenesulfonic acid |
| SMILES | N/C(=N\c1ccc(Cc2ccc(S(=O)(=O)O)cc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O3S/c21-17-7-5-16(6-8-17)20(22)23-18-9-1-14(2-10-18)13-15-3-11-19(12-4-15)27(24,25)26/h1-12H,13H2,(H2,22,23)(H,24,25,26) |
| InChIKey | OXBABJCUSHBLFT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|