C17H20ClN3O3S — CID 139644904
3-(2-chlorophenyl)-1-[(4-methylphenyl)sulfonylamino]-1-propylurea (PubChem CID 139644904) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-[(4-methylphenyl)sulfonylamino]-1-propylurea.
| Compound Name | 3-(2-chlorophenyl)-1-[(4-methylphenyl)sulfonylamino]-1-propylurea |
|---|---|
| PubChem CID | 139644904 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-(2-chlorophenyl)-1-[(4-methylphenyl)sulfonylamino]-1-propylurea |
| SMILES | CCCN(NS(=O)(=O)c1ccc(C)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3O3S/c1-3-12-21(17(22)19-16-7-5-4-6-15(16)18)20-25(23,24)14-10-8-13(2)9-11-14/h4-11,20H,3,12H2,1-2H3,(H,19,22) |
| InChIKey | XBWXPDWYYOSHQA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|