C17H19ClN2O2S2 — CID 148551338
1-(2-chlorophenyl)-3-[3-(4-methylphenyl)sulfonylpropyl]thiourea (PubChem CID 148551338) has the molecular formula C17H19ClN2O2S2 and a molecular weight of 382.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(4-methylphenyl)sulfonylpropyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(4-methylphenyl)sulfonylpropyl]thiourea |
|---|---|
| PubChem CID | 148551338 |
| Molecular Formula | C17H19ClN2O2S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(4-methylphenyl)sulfonylpropyl]thiourea |
| SMILES | Cc1ccc(S(=O)(=O)CCCNC(=S)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O2S2/c1-13-7-9-14(10-8-13)24(21,22)12-4-11-19-17(23)20-16-6-3-2-5-15(16)18/h2-3,5-10H,4,11-12H2,1H3,(H2,19,20,23) |
| InChIKey | MTFFIWXCHZSYHA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|