C15H17ClN4O2S — CID 139645081
1-amino-3-(4-chlorophenyl)-1-methyl-2-(2-methylphenyl)sulfonylguanidine (PubChem CID 139645081) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is 1-amino-3-(4-chlorophenyl)-1-methyl-2-(2-methylphenyl)sulfonylguanidine.
| Compound Name | 1-amino-3-(4-chlorophenyl)-1-methyl-2-(2-methylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 139645081 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-amino-3-(4-chlorophenyl)-1-methyl-2-(2-methylphenyl)sulfonylguanidine |
| SMILES | Cc1ccccc1S(=O)(=O)N=C(Nc1ccc(Cl)cc1)N(C)N |
| InChI | InChI=1S/C15H17ClN4O2S/c1-11-5-3-4-6-14(11)23(21,22)19-15(20(2)17)18-13-9-7-12(16)8-10-13/h3-10H,17H2,1-2H3,(H,18,19) |
| InChIKey | ROCHNFSZLOTGOT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|