C10H22N2O4 — CID 139645368
1,1,3-tris(1-hydroxypropan-2-yl)urea (PubChem CID 139645368) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,1,3-tris(1-hydroxypropan-2-yl)urea.
| Compound Name | 1,1,3-tris(1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 139645368 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1,1,3-tris(1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)NC(=O)N(C(C)CO)C(C)CO |
| InChI | InChI=1S/C10H22N2O4/c1-7(4-13)11-10(16)12(8(2)5-14)9(3)6-15/h7-9,13-15H,4-6H2,1-3H3,(H,11,16) |
| InChIKey | CVRULRCUBGIYTJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |