C14H29ClN4O2 — CID 139646660
N-[(2S,3S)-2-butoxy-1-carbamimidoylpiperidin-3-yl]butanamide;hydrochloride (PubChem CID 139646660) has the molecular formula C14H29ClN4O2 and a molecular weight of 320.87 g/mol. Its IUPAC name is N-[(2S,3S)-2-butoxy-1-carbamimidoylpiperidin-3-yl]butanamide;hydrochloride.
| Compound Name | N-[(2S,3S)-2-butoxy-1-carbamimidoylpiperidin-3-yl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 139646660 |
| Molecular Formula | C14H29ClN4O2 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[(2S,3S)-2-butoxy-1-carbamimidoylpiperidin-3-yl]butanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCC[C@H](NC(=O)CCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C14H28N4O2.ClH/c1-3-5-10-20-13-11(17-12(19)7-4-2)8-6-9-18(13)14(15)16;/h11,13H,3-10H2,1-2H3,(H3,15,16)(H,17,19);1H/t11-,13-;/m0./s1 |
| InChIKey | HSLHSMSFRACIHE-JZKFLRDJSA-N |
| XLogP | 1.83 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|