C22H40N6O8 — CID 59904397
butyl [(2R)-3-[[(2S)-1-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-2-(2-methylpropoxycarbonylamino)-3-oxopropyl] carbonate (PubChem CID 59904397) has the molecular formula C22H40N6O8 and a molecular weight of 516.60 g/mol. Its IUPAC name is butyl [(2R)-3-[[(2S)-1-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-2-(2-methylpropoxycarbonylamino)-3-oxopropyl] carbonate.
| Compound Name | butyl [(2R)-3-[[(2S)-1-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-2-(2-methylpropoxycarbonylamino)-3-oxopropyl] carbonate |
|---|---|
| PubChem CID | 59904397 |
| Molecular Formula | C22H40N6O8 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | butyl [(2R)-3-[[(2S)-1-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-2-(2-methylpropoxycarbonylamino)-3-oxopropyl] carbonate |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](COC(=O)OCCCC)NC(=O)OCC(C)C)C1O |
| InChI | InChI=1S/C22H40N6O8/c1-5-6-10-34-22(33)36-12-16(27-21(32)35-11-13(2)3)18(30)25-14(4)17(29)26-15-8-7-9-28(19(15)31)20(23)24/h13-16,19,31H,5-12H2,1-4H3,(H3,23,24)(H,25,30)(H,26,29)(H,27,32)/t14-,15-,16+,19?/m0/s1 |
| InChIKey | DTEUVNPTLXODIL-IZQGTLBWSA-N |
| XLogP | -0.01 |
| TPSA | 205.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|