C32H56N6O9 — CID 22958003
prop-2-enyl (NE)-N-[amino-[3-[2-[[3-[(2-methylpropan-2-yl)oxy]-2-(2-methylpropoxycarbonylamino)propanoyl]amino]propanoylamino]-2-(6-oxoheptoxy)piperidin-1-yl]methylidene]carbamate (PubChem CID 22958003) has the molecular formula C32H56N6O9 and a molecular weight of 668.83 g/mol. Its IUPAC name is prop-2-enyl (NE)-N-[amino-[3-[2-[[3-[(2-methylpropan-2-yl)oxy]-2-(2-methylpropoxycarbonylamino)propanoyl]amino]propanoylamino]-2-(6-oxoheptoxy)piperidin-1-yl]methylidene]carbamate.
| Compound Name | prop-2-enyl (NE)-N-[amino-[3-[2-[[3-[(2-methylpropan-2-yl)oxy]-2-(2-methylpropoxycarbonylamino)propanoyl]amino]propanoylamino]-2-(6-oxoheptoxy)piperidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 22958003 |
| Molecular Formula | C32H56N6O9 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | prop-2-enyl (NE)-N-[amino-[3-[2-[[3-[(2-methylpropan-2-yl)oxy]-2-(2-methylpropoxycarbonylamino)propanoyl]amino]propanoylamino]-2-(6-oxoheptoxy)piperidin-1-yl]methylidene]carbamate |
| SMILES | C=CCOC(=O)/N=C(\N)N1CCCC(NC(=O)C(C)NC(=O)C(COC(C)(C)C)NC(=O)OCC(C)C)C1OCCCCCC(C)=O |
| InChI | InChI=1S/C32H56N6O9/c1-9-17-45-31(43)37-29(33)38-16-13-15-24(28(38)44-18-12-10-11-14-22(4)39)35-26(40)23(5)34-27(41)25(20-47-32(6,7)8)36-30(42)46-19-21(2)3/h9,21,23-25,28H,1,10-20H2,2-8H3,(H,34,41)(H,35,40)(H,36,42)(H2,33,37,43) |
| InChIKey | RWRURCHPWXRWSR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|