C19H35N7O8 — CID 59904359
2-methylpropyl N-[(2R)-1-[[(2S)-1-[[2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 59904359) has the molecular formula C19H35N7O8 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-methylpropyl N-[(2R)-1-[[(2S)-1-[[2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(2R)-1-[[(2S)-1-[[2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59904359 |
| Molecular Formula | C19H35N7O8 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 2-methylpropyl N-[(2R)-1-[[(2S)-1-[[2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCOC1C(NC(=O)[C@H](C)NC(=O)[C@@H](CO)NC(=O)OCC(C)C)CCCN1/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C19H35N7O8/c1-5-33-17-13(7-6-8-25(17)18(20)24-26(31)32)22-15(28)12(4)21-16(29)14(9-27)23-19(30)34-10-11(2)3/h11-14,17,27H,5-10H2,1-4H3,(H2,20,24)(H,21,29)(H,22,28)(H,23,30)/t12-,13?,14+,17?/m0/s1 |
| InChIKey | NZZDYLBQKSDESM-XCCIUEIHSA-N |
| XLogP | -1.32 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|