C21H31N7O7S — CID 10815936
2-[(3S)-3-(benzenesulfonamido)-2-oxopiperidin-1-yl]-N-[(3S)-2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]acetamide (PubChem CID 10815936) has the molecular formula C21H31N7O7S and a molecular weight of 525.59 g/mol. Its IUPAC name is 2-[(3S)-3-(benzenesulfonamido)-2-oxopiperidin-1-yl]-N-[(3S)-2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-3-(benzenesulfonamido)-2-oxopiperidin-1-yl]-N-[(3S)-2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 10815936 |
| Molecular Formula | C21H31N7O7S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 2-[(3S)-3-(benzenesulfonamido)-2-oxopiperidin-1-yl]-N-[(3S)-2-ethoxy-1-[(E)-N'-nitrocarbamimidoyl]piperidin-3-yl]acetamide |
| SMILES | CCOC1[C@@H](NC(=O)CN2CCC[C@H](NS(=O)(=O)c3ccccc3)C2=O)CCCN1/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C21H31N7O7S/c1-2-35-20-17(11-7-13-27(20)21(22)24-28(31)32)23-18(29)14-26-12-6-10-16(19(26)30)25-36(33,34)15-8-4-3-5-9-15/h3-5,8-9,16-17,20,25H,2,6-7,10-14H2,1H3,(H2,22,24)(H,23,29)/t16-,17-,20?/m0/s1 |
| InChIKey | LBXFHCTWRZODOA-NBJLRHFZSA-N |
| XLogP | -0.59 |
| TPSA | 189.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|