C11H23N5O3 — CID 22957988
2-ethoxy-N'-nitro-3-(propan-2-ylamino)piperidine-1-carboximidamide (PubChem CID 22957988) has the molecular formula C11H23N5O3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-ethoxy-N'-nitro-3-(propan-2-ylamino)piperidine-1-carboximidamide.
| Compound Name | 2-ethoxy-N'-nitro-3-(propan-2-ylamino)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 22957988 |
| Molecular Formula | C11H23N5O3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-ethoxy-N'-nitro-3-(propan-2-ylamino)piperidine-1-carboximidamide |
| SMILES | CCOC1C(NC(C)C)CCCN1/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C11H23N5O3/c1-4-19-10-9(13-8(2)3)6-5-7-15(10)11(12)14-16(17)18/h8-10,13H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | SKSRMCAZRNKOEM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|