C18H33N7O5 — CID 173091406
(2S)-1-acetyl-N-[(2R)-2-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 173091406) has the molecular formula C18H33N7O5 and a molecular weight of 427.51 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(2R)-2-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[(2R)-2-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 173091406 |
| Molecular Formula | C18H33N7O5 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (2S)-1-acetyl-N-[(2R)-2-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCC[C@](N=C(N)N[N+](=O)[O-])(NC(=O)[C@@H]1CCCN1C(C)=O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C18H33N7O5/c1-5-9-18(22-17(19)23-25(29)30,16(28)20-10-8-12(2)3)21-15(27)14-7-6-11-24(14)13(4)26/h12,14H,5-11H2,1-4H3,(H,20,28)(H,21,27)(H3,19,22,23)/t14-,18+/m0/s1 |
| InChIKey | HSUGTZCTUFKULW-KBXCAEBGSA-N |
| XLogP | -0.13 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|