C19H36N4O4 — CID 59908753
(2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(3-methylbutyl)-1-N-(4-methylpentyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 59908753) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(3-methylbutyl)-1-N-(4-methylpentyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(3-methylbutyl)-1-N-(4-methylpentyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59908753 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(3-methylbutyl)-1-N-(4-methylpentyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)CCCN(CC(=O)NO)C(=O)N1CCC[C@H]1C(=O)NCCC(C)C |
| InChI | InChI=1S/C19H36N4O4/c1-14(2)7-5-11-22(13-17(24)21-27)19(26)23-12-6-8-16(23)18(25)20-10-9-15(3)4/h14-16,27H,5-13H2,1-4H3,(H,20,25)(H,21,24)/t16-/m0/s1 |
| InChIKey | OYEIBUWWFMNRMG-INIZCTEOSA-N |
| XLogP | 1.98 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|