C22H34N4O4 — CID 59908765
(2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-1-N-(3-methylbutyl)-2-N-(4-propan-2-ylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 59908765) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-1-N-(3-methylbutyl)-2-N-(4-propan-2-ylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-1-N-(3-methylbutyl)-2-N-(4-propan-2-ylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59908765 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2S)-1-N-[2-(hydroxyamino)-2-oxoethyl]-1-N-(3-methylbutyl)-2-N-(4-propan-2-ylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)CCN(CC(=O)NO)C(=O)N1CCC[C@H]1C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H34N4O4/c1-15(2)11-13-25(14-20(27)24-30)22(29)26-12-5-6-19(26)21(28)23-18-9-7-17(8-10-18)16(3)4/h7-10,15-16,19,30H,5-6,11-14H2,1-4H3,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | HOSUPDMILBYESK-IBGZPJMESA-N |
| XLogP | 3.19 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|