C18H28N6O4S — CID 59908762
(2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-1,2-dicarboxamide (PubChem CID 59908762) has the molecular formula C18H28N6O4S and a molecular weight of 424.53 g/mol. Its IUPAC name is (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59908762 |
| Molecular Formula | C18H28N6O4S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (2S)-1-N-(2-cyclopentylethyl)-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1nnc(NC(=O)[C@@H]2CCCN2C(=O)N(CCC2CCCC2)CC(=O)NO)s1 |
| InChI | InChI=1S/C18H28N6O4S/c1-12-20-21-17(29-12)19-16(26)14-7-4-9-24(14)18(27)23(11-15(25)22-28)10-8-13-5-2-3-6-13/h13-14,28H,2-11H2,1H3,(H,22,25)(H,19,21,26)/t14-/m0/s1 |
| InChIKey | QZCXAVCASPGVKC-AWEZNQCLSA-N |
| XLogP | 1.76 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|