C28H52N6O7 — CID 22958001
2-methylpropyl N-[1-[[1-[[1-carbamimidoyl-2-(6-oxoheptoxy)piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate (PubChem CID 22958001) has the molecular formula C28H52N6O7 and a molecular weight of 584.76 g/mol. Its IUPAC name is 2-methylpropyl N-[1-[[1-[[1-carbamimidoyl-2-(6-oxoheptoxy)piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[1-[[1-[[1-carbamimidoyl-2-(6-oxoheptoxy)piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22958001 |
| Molecular Formula | C28H52N6O7 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | 2-methylpropyl N-[1-[[1-[[1-carbamimidoyl-2-(6-oxoheptoxy)piperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)N1CCCC(NC(=O)C(C)NC(=O)C(COC(C)(C)C)NC(=O)OCC(C)C)C1OCCCCCC(C)=O |
| InChI | InChI=1S/C28H52N6O7/c1-18(2)16-40-27(38)33-22(17-41-28(5,6)7)24(37)31-20(4)23(36)32-21-13-11-14-34(26(29)30)25(21)39-15-10-8-9-12-19(3)35/h18,20-22,25H,8-17H2,1-7H3,(H3,29,30)(H,31,37)(H,32,36)(H,33,38) |
| InChIKey | DKAFVIGYHMHWIX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 185.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|